C33H34O10 — CID 153042578
2-O,4-O-bis(4-oxo-4-phenoxybutyl) 1-O-phenyl butane-1,2,4-tricarboxylate (PubChem CID 153042578) has the molecular formula C33H34O10 and a molecular weight of 590.63 g/mol. Its IUPAC name is 2-O,4-O-bis(4-oxo-4-phenoxybutyl) 1-O-phenyl butane-1,2,4-tricarboxylate.
| Compound Name | 2-O,4-O-bis(4-oxo-4-phenoxybutyl) 1-O-phenyl butane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 153042578 |
| Molecular Formula | C33H34O10 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-O,4-O-bis(4-oxo-4-phenoxybutyl) 1-O-phenyl butane-1,2,4-tricarboxylate |
| SMILES | O=C(CCC(CC(=O)Oc1ccccc1)C(=O)OCCCC(=O)Oc1ccccc1)OCCCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C33H34O10/c34-29(39-22-10-18-30(35)41-26-12-4-1-5-13-26)21-20-25(24-32(37)43-28-16-8-3-9-17-28)33(38)40-23-11-19-31(36)42-27-14-6-2-7-15-27/h1-9,12-17,25H,10-11,18-24H2 |
| InChIKey | VFZDIBFBJMXTFY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|