About 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate
1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate (PubChem CID 161475773) has the molecular formula C23H27NO6
and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate |
| PubChem CID | 161475773 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate |
| SMILES | CCC(C)C(CC(=O)Oc1ccccc1)C(=O)OCCNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C23H27NO6/c1-3-17(2)20(16-21(25)29-18-10-6-4-7-11-18)22(26)28-15-14-24-23(27)30-19-12-8-5-9-13-19/h4-13,17,20H,3,14-16H2,1-2H3,(H,24,27) |
| InChIKey | WDRPEPALCGGSKD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate?
The IUPAC name of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate (CID 161475773) is 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate.
What is the SMILES notation for 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate?
The canonical SMILES for 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate is CCC(C)C(CC(=O)Oc1ccccc1)C(=O)OCCNC(=O)Oc1ccccc1.
What is the InChIKey of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate?
The InChIKey is WDRPEPALCGGSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO6/c1-3-17(2)20(16-21(25)29-18-10-6-4-7-11-18)22(26)28-15-14-24-23(27)30-19-12-8-5-9-13-19/h4-13,17,20H,3,14-16H2,1-2H3,(H,24,27).
What are the key properties of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate?
1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate has a molecular weight of 413.47 g/mol, XLogP of 3.98, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-butan-2-ylbutanedioate is sourced from PubChem (CID 161475773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).