About diphenyl 2-methylbutanedioate
diphenyl 2-methylbutanedioate (PubChem CID 19419895) has the molecular formula C17H16O4
and a molecular weight of 284.31 g/mol. Its IUPAC name is diphenyl 2-methylbutanedioate.
Molecular Properties
| Compound Name | diphenyl 2-methylbutanedioate |
| PubChem CID | 19419895 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | diphenyl 2-methylbutanedioate |
| SMILES | CC(CC(=O)Oc1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H16O4/c1-13(17(19)21-15-10-6-3-7-11-15)12-16(18)20-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3 |
| InChIKey | SRCWBAZVUBMHFG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze diphenyl 2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl 2-methylbutanedioate?
The IUPAC name of diphenyl 2-methylbutanedioate (CID 19419895) is diphenyl 2-methylbutanedioate.
What is the SMILES notation for diphenyl 2-methylbutanedioate?
The canonical SMILES for diphenyl 2-methylbutanedioate is CC(CC(=O)Oc1ccccc1)C(=O)Oc1ccccc1.
What is the InChIKey of diphenyl 2-methylbutanedioate?
The InChIKey is SRCWBAZVUBMHFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O4/c1-13(17(19)21-15-10-6-3-7-11-15)12-16(18)20-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3.
What are the key properties of diphenyl 2-methylbutanedioate?
diphenyl 2-methylbutanedioate has a molecular weight of 284.31 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl 2-methylbutanedioate is sourced from PubChem (CID 19419895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).