About bis(4-butoxyphenyl) 2-methylbutanedioate
bis(4-butoxyphenyl) 2-methylbutanedioate (PubChem CID 139759305) has the molecular formula C25H32O6
and a molecular weight of 428.53 g/mol. Its IUPAC name is bis(4-butoxyphenyl) 2-methylbutanedioate.
Molecular Properties
| Compound Name | bis(4-butoxyphenyl) 2-methylbutanedioate |
| PubChem CID | 139759305 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | bis(4-butoxyphenyl) 2-methylbutanedioate |
| SMILES | CCCCOc1ccc(OC(=O)CC(C)C(=O)Oc2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C25H32O6/c1-4-6-16-28-20-8-12-22(13-9-20)30-24(26)18-19(3)25(27)31-23-14-10-21(11-15-23)29-17-7-5-2/h8-15,19H,4-7,16-18H2,1-3H3 |
| InChIKey | KIVPNFLFQIQGEF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-butoxyphenyl) 2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-butoxyphenyl) 2-methylbutanedioate?
The IUPAC name of bis(4-butoxyphenyl) 2-methylbutanedioate (CID 139759305) is bis(4-butoxyphenyl) 2-methylbutanedioate.
What is the SMILES notation for bis(4-butoxyphenyl) 2-methylbutanedioate?
The canonical SMILES for bis(4-butoxyphenyl) 2-methylbutanedioate is CCCCOc1ccc(OC(=O)CC(C)C(=O)Oc2ccc(OCCCC)cc2)cc1.
What is the InChIKey of bis(4-butoxyphenyl) 2-methylbutanedioate?
The InChIKey is KIVPNFLFQIQGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32O6/c1-4-6-16-28-20-8-12-22(13-9-20)30-24(26)18-19(3)25(27)31-23-14-10-21(11-15-23)29-17-7-5-2/h8-15,19H,4-7,16-18H2,1-3H3.
What are the key properties of bis(4-butoxyphenyl) 2-methylbutanedioate?
bis(4-butoxyphenyl) 2-methylbutanedioate has a molecular weight of 428.53 g/mol, XLogP of 5.58, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-butoxyphenyl) 2-methylbutanedioate is sourced from PubChem (CID 139759305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).