About phenyl (3S)-3-hydroxyhexanoate
phenyl (3S)-3-hydroxyhexanoate (PubChem CID 15933496) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is phenyl (3S)-3-hydroxyhexanoate.
Molecular Properties
| Compound Name | phenyl (3S)-3-hydroxyhexanoate |
| PubChem CID | 15933496 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | phenyl (3S)-3-hydroxyhexanoate |
| SMILES | CCC[C@H](O)CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H16O3/c1-2-6-10(13)9-12(14)15-11-7-4-3-5-8-11/h3-5,7-8,10,13H,2,6,9H2,1H3/t10-/m0/s1 |
| InChIKey | KBAQVHHXBXRVNK-JTQLQIEISA-N |
| XLogP | 2.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl (3S)-3-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (3S)-3-hydroxyhexanoate?
The IUPAC name of phenyl (3S)-3-hydroxyhexanoate (CID 15933496) is phenyl (3S)-3-hydroxyhexanoate.
What is the SMILES notation for phenyl (3S)-3-hydroxyhexanoate?
The canonical SMILES for phenyl (3S)-3-hydroxyhexanoate is CCC[C@H](O)CC(=O)Oc1ccccc1.
What is the InChIKey of phenyl (3S)-3-hydroxyhexanoate?
The InChIKey is KBAQVHHXBXRVNK-JTQLQIEISA-N. The full InChI is InChI=1S/C12H16O3/c1-2-6-10(13)9-12(14)15-11-7-4-3-5-8-11/h3-5,7-8,10,13H,2,6,9H2,1H3/t10-/m0/s1.
What are the key properties of phenyl (3S)-3-hydroxyhexanoate?
phenyl (3S)-3-hydroxyhexanoate has a molecular weight of 208.26 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (3S)-3-hydroxyhexanoate is sourced from PubChem (CID 15933496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).