About phenyl 2-hydroxypentanoate
phenyl 2-hydroxypentanoate (PubChem CID 141237122) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is phenyl 2-hydroxypentanoate.
Molecular Properties
| Compound Name | phenyl 2-hydroxypentanoate |
| PubChem CID | 141237122 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | phenyl 2-hydroxypentanoate |
| SMILES | CCCC(O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H14O3/c1-2-6-10(12)11(13)14-9-7-4-3-5-8-9/h3-5,7-8,10,12H,2,6H2,1H3 |
| InChIKey | FZGVSNZANPZLKA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-hydroxypentanoate?
The IUPAC name of phenyl 2-hydroxypentanoate (CID 141237122) is phenyl 2-hydroxypentanoate.
What is the SMILES notation for phenyl 2-hydroxypentanoate?
The canonical SMILES for phenyl 2-hydroxypentanoate is CCCC(O)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-hydroxypentanoate?
The InChIKey is FZGVSNZANPZLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-6-10(12)11(13)14-9-7-4-3-5-8-9/h3-5,7-8,10,12H,2,6H2,1H3.
What are the key properties of phenyl 2-hydroxypentanoate?
phenyl 2-hydroxypentanoate has a molecular weight of 194.23 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-hydroxypentanoate is sourced from PubChem (CID 141237122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).