C25H24N2O6 — CID 146513968
2-(phenoxycarbonylamino)ethyl 2-(phenoxycarbonylamino)-3-phenylpropanoate (PubChem CID 146513968) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(phenoxycarbonylamino)ethyl 2-(phenoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | 2-(phenoxycarbonylamino)ethyl 2-(phenoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 146513968 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-(phenoxycarbonylamino)ethyl 2-(phenoxycarbonylamino)-3-phenylpropanoate |
| SMILES | O=C(NCCOC(=O)C(Cc1ccccc1)NC(=O)Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H24N2O6/c28-23(31-17-16-26-24(29)32-20-12-6-2-7-13-20)22(18-19-10-4-1-5-11-19)27-25(30)33-21-14-8-3-9-15-21/h1-15,22H,16-18H2,(H,26,29)(H,27,30) |
| InChIKey | CGNJLKKCPDDRIO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|