C22H28INO4Si — CID 10098345
2-trimethylsilylethyl (2S)-3-(4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 10098345) has the molecular formula C22H28INO4Si and a molecular weight of 525.46 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S)-3-(4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | 2-trimethylsilylethyl (2S)-3-(4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10098345 |
| Molecular Formula | C22H28INO4Si |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 2-trimethylsilylethyl (2S)-3-(4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C[Si](C)(C)CCOC(=O)[C@H](Cc1ccc(I)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H28INO4Si/c1-29(2,3)14-13-27-21(25)20(15-17-9-11-19(23)12-10-17)24-22(26)28-16-18-7-5-4-6-8-18/h4-12,20H,13-16H2,1-3H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | YHBUEQXFRMSFLE-FQEVSTJZSA-N |
| XLogP | 5.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|