C40H47BrN2O8 — CID 91271116
butyl 2-bromo-3-phenylpropanoate;butyl 2-(phenoxycarbonylamino)-3-phenylpropanoate;phenyl carbamate (PubChem CID 91271116) has the molecular formula C40H47BrN2O8 and a molecular weight of 763.73 g/mol. Its IUPAC name is butyl 2-bromo-3-phenylpropanoate;butyl 2-(phenoxycarbonylamino)-3-phenylpropanoate;phenyl carbamate.
| Compound Name | butyl 2-bromo-3-phenylpropanoate;butyl 2-(phenoxycarbonylamino)-3-phenylpropanoate;phenyl carbamate |
|---|---|
| PubChem CID | 91271116 |
| Molecular Formula | C40H47BrN2O8 |
| Molecular Weight | 763.73 g/mol |
| Exact Mass | 762.25 |
| IUPAC Name | butyl 2-bromo-3-phenylpropanoate;butyl 2-(phenoxycarbonylamino)-3-phenylpropanoate;phenyl carbamate |
| SMILES | CCCCOC(=O)C(Br)Cc1ccccc1.CCCCOC(=O)C(Cc1ccccc1)NC(=O)Oc1ccccc1.NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H23NO4.C13H17BrO2.C7H7NO2/c1-2-3-14-24-19(22)18(15-16-10-6-4-7-11-16)21-20(23)25-17-12-8-5-9-13-17;1-2-3-9-16-13(15)12(14)10-11-7-5-4-6-8-11;8-7(9)10-6-4-2-1-3-5-6/h4-13,18H,2-3,14-15H2,1H3,(H,21,23);4-8,12H,2-3,9-10H2,1H3;1-5H,(H2,8,9) |
| InChIKey | UIHKWUZNDAPBHR-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.73 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|