C22H35NO4 — CID 20836705
octyl (2S)-2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate (PubChem CID 20836705) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is octyl (2S)-2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | octyl (2S)-2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 20836705 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | octyl (2S)-2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate |
| SMILES | CCCCCCCCOC(=O)[C@H](Cc1ccccc1)NC(=O)OCC(C)C |
| InChI | InChI=1S/C22H35NO4/c1-4-5-6-7-8-12-15-26-21(24)20(16-19-13-10-9-11-14-19)23-22(25)27-17-18(2)3/h9-11,13-14,18,20H,4-8,12,15-17H2,1-3H3,(H,23,25)/t20-/m0/s1 |
| InChIKey | MHHXDCZIUUTDSO-FQEVSTJZSA-N |
| XLogP | 4.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|