C19H31ClN2O3 — CID 56675782
octyl (2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoate;hydrochloride (PubChem CID 56675782) has the molecular formula C19H31ClN2O3 and a molecular weight of 370.92 g/mol. Its IUPAC name is octyl (2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoate;hydrochloride.
| Compound Name | octyl (2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 56675782 |
| Molecular Formula | C19H31ClN2O3 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | octyl (2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoate;hydrochloride |
| SMILES | CCCCCCCCOC(=O)[C@H](Cc1ccccc1)NC(=O)CN.Cl |
| InChI | InChI=1S/C19H30N2O3.ClH/c1-2-3-4-5-6-10-13-24-19(23)17(21-18(22)15-20)14-16-11-8-7-9-12-16;/h7-9,11-12,17H,2-6,10,13-15,20H2,1H3,(H,21,22);1H/t17-;/m0./s1 |
| InChIKey | NPMWEJXRPMIZGB-LMOVPXPDSA-N |
| XLogP | 3.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|