C32H57N2O3+ — CID 101032625
[10-[(1-decoxy-1-oxo-3-phenylpropan-2-yl)amino]-10-oxodecyl]-trimethylazanium (PubChem CID 101032625) has the molecular formula C32H57N2O3+ and a molecular weight of 517.82 g/mol. Its IUPAC name is [10-[(1-decoxy-1-oxo-3-phenylpropan-2-yl)amino]-10-oxodecyl]-trimethylazanium.
| Compound Name | [10-[(1-decoxy-1-oxo-3-phenylpropan-2-yl)amino]-10-oxodecyl]-trimethylazanium |
|---|---|
| PubChem CID | 101032625 |
| Molecular Formula | C32H57N2O3+ |
| Molecular Weight | 517.82 g/mol |
| Exact Mass | 517.44 |
| IUPAC Name | [10-[(1-decoxy-1-oxo-3-phenylpropan-2-yl)amino]-10-oxodecyl]-trimethylazanium |
| SMILES | CCCCCCCCCCOC(=O)C(Cc1ccccc1)NC(=O)CCCCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C32H56N2O3/c1-5-6-7-8-9-13-16-22-27-37-32(36)30(28-29-23-18-17-19-24-29)33-31(35)25-20-14-11-10-12-15-21-26-34(2,3)4/h17-19,23-24,30H,5-16,20-22,25-28H2,1-4H3/p+1 |
| InChIKey | AVRUFJVUTAPOHL-UHFFFAOYSA-O |
| XLogP | 7.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|