C20H26F5NO3 — CID 91719484
octyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate (PubChem CID 91719484) has the molecular formula C20H26F5NO3 and a molecular weight of 423.42 g/mol. Its IUPAC name is octyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate.
| Compound Name | octyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 91719484 |
| Molecular Formula | C20H26F5NO3 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | octyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
| SMILES | CCCCCCCCOC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H26F5NO3/c1-2-3-4-5-6-10-13-29-17(27)16(14-15-11-8-7-9-12-15)26-18(28)19(21,22)20(23,24)25/h7-9,11-12,16H,2-6,10,13-14H2,1H3,(H,26,28) |
| InChIKey | PHECSIOHURIUHP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|