C24H39NO4 — CID 6420858
decyl 2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate (PubChem CID 6420858) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is decyl 2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | decyl 2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 6420858 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | decyl 2-(2-methylpropoxycarbonylamino)-3-phenylpropanoate |
| SMILES | CCCCCCCCCCOC(=O)C(Cc1ccccc1)NC(=O)OCC(C)C |
| InChI | InChI=1S/C24H39NO4/c1-4-5-6-7-8-9-10-14-17-28-23(26)22(18-21-15-12-11-13-16-21)25-24(27)29-19-20(2)3/h11-13,15-16,20,22H,4-10,14,17-19H2,1-3H3,(H,25,27) |
| InChIKey | YPEHDZXCZCMPAF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|