C23H33NO4 — CID 91719524
decyl 3-phenyl-2-(prop-2-ynoxycarbonylamino)propanoate (PubChem CID 91719524) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is decyl 3-phenyl-2-(prop-2-ynoxycarbonylamino)propanoate.
| Compound Name | decyl 3-phenyl-2-(prop-2-ynoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 91719524 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | decyl 3-phenyl-2-(prop-2-ynoxycarbonylamino)propanoate |
| SMILES | C#CCOC(=O)NC(Cc1ccccc1)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C23H33NO4/c1-3-5-6-7-8-9-10-14-18-27-22(25)21(24-23(26)28-17-4-2)19-20-15-12-11-13-16-20/h2,11-13,15-16,21H,3,5-10,14,17-19H2,1H3,(H,24,26) |
| InChIKey | NJCKLSUMZNFBQY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|