C29H29F3N4O8 — CID 44784119
(4-nitrophenyl)methyl 2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate;2,2,2-trifluoroacetic acid (PubChem CID 44784119) has the molecular formula C29H29F3N4O8 and a molecular weight of 618.57 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-nitrophenyl)methyl 2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44784119 |
| Molecular Formula | C29H29F3N4O8 |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate;2,2,2-trifluoroacetic acid |
| SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)OCc1ccc([N+](=O)[O-])cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H28N4O6.C2HF3O2/c28-17-25(32)29-23(15-19-7-3-1-4-8-19)26(33)30-24(16-20-9-5-2-6-10-20)27(34)37-18-21-11-13-22(14-12-21)31(35)36;3-2(4,5)1(6)7/h1-14,23-24H,15-18,28H2,(H,29,32)(H,30,33);(H,6,7) |
| InChIKey | WHWVCBAEGPEOFO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 190.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|