C16H22N2O5 — CID 99868555
(4-nitrophenyl) (2R)-2-(3-methoxypropyl)piperidine-1-carboxylate (PubChem CID 99868555) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (4-nitrophenyl) (2R)-2-(3-methoxypropyl)piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) (2R)-2-(3-methoxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 99868555 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (4-nitrophenyl) (2R)-2-(3-methoxypropyl)piperidine-1-carboxylate |
| SMILES | COCCC[C@H]1CCCCN1C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-22-12-4-6-13-5-2-3-11-17(13)16(19)23-15-9-7-14(8-10-15)18(20)21/h7-10,13H,2-6,11-12H2,1H3/t13-/m1/s1 |
| InChIKey | XVBRVSAGMWRVCK-CYBMUJFWSA-N |
| XLogP | 3.37 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|