About (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride
(1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride (PubChem CID 118057504) has the molecular formula C14H19ClN2O5
and a molecular weight of 330.77 g/mol. Its IUPAC name is (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride |
| PubChem CID | 118057504 |
| Molecular Formula | C14H19ClN2O5 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride |
| SMILES | CN1CCCCC1COC(=O)Oc1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C14H18N2O5.ClH/c1-15-9-3-2-4-12(15)10-20-14(17)21-13-7-5-11(6-8-13)16(18)19;/h5-8,12H,2-4,9-10H2,1H3;1H |
| InChIKey | XHXIBPRPXWDKPU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride?
The IUPAC name of (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride (CID 118057504) is (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride.
What is the SMILES notation for (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride?
The canonical SMILES for (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride is CN1CCCCC1COC(=O)Oc1ccc([N+](=O)[O-])cc1.Cl.
What is the InChIKey of (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride?
The InChIKey is XHXIBPRPXWDKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O5.ClH/c1-15-9-3-2-4-12(15)10-20-14(17)21-13-7-5-11(6-8-13)16(18)19;/h5-8,12H,2-4,9-10H2,1H3;1H.
What are the key properties of (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride?
(1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride has a molecular weight of 330.77 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-2-yl)methyl (4-nitrophenyl) carbonate;hydrochloride is sourced from PubChem (CID 118057504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).