C20H25NO5 — CID 155748779
9-bicyclo[6.1.0]non-4-ynylmethyl (4-nitrophenyl) carbonate;propane (PubChem CID 155748779) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 9-bicyclo[6.1.0]non-4-ynylmethyl (4-nitrophenyl) carbonate;propane.
| Compound Name | 9-bicyclo[6.1.0]non-4-ynylmethyl (4-nitrophenyl) carbonate;propane |
|---|---|
| PubChem CID | 155748779 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 9-bicyclo[6.1.0]non-4-ynylmethyl (4-nitrophenyl) carbonate;propane |
| SMILES | CCC.O=C(OCC1C2CCC#CCCC21)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17NO5.C3H8/c19-17(23-13-9-7-12(8-10-13)18(20)21)22-11-16-14-5-3-1-2-4-6-15(14)16;1-3-2/h7-10,14-16H,3-6,11H2;3H2,1-2H3 |
| InChIKey | NTEKLCSQKOJNLZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|