C23H29N3O9S — CID 177293538
5-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]pentyl (4-nitrophenyl) carbonate (PubChem CID 177293538) has the molecular formula C23H29N3O9S and a molecular weight of 523.56 g/mol. Its IUPAC name is 5-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]pentyl (4-nitrophenyl) carbonate.
| Compound Name | 5-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]pentyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 177293538 |
| Molecular Formula | C23H29N3O9S |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 5-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]pentyl (4-nitrophenyl) carbonate |
| SMILES | O=C(NS(=O)(=O)NCCCCCOC(=O)Oc1ccc([N+](=O)[O-])cc1)OCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C23H29N3O9S/c27-22(34-16-21-19-8-4-1-2-5-9-20(19)21)25-36(31,32)24-14-6-3-7-15-33-23(28)35-18-12-10-17(11-13-18)26(29)30/h10-13,19-21,24H,3-9,14-16H2,(H,25,27)/t19-,20+,21? |
| InChIKey | SOOBUYBLDJQFQT-WCRBZPEASA-N |
| XLogP | 3.28 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|