About [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride
[2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride (PubChem CID 141393691) has the molecular formula C15H21ClN2O5
and a molecular weight of 344.80 g/mol. Its IUPAC name is [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride.
Molecular Properties
| Compound Name | [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride |
| PubChem CID | 141393691 |
| Molecular Formula | C15H21ClN2O5 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride |
| SMILES | CN1CCCCC1CCc1cc([N+](=O)[O-])ccc1OC(=O)O.Cl |
| InChI | InChI=1S/C15H20N2O5.ClH/c1-16-9-3-2-4-12(16)6-5-11-10-13(17(20)21)7-8-14(11)22-15(18)19;/h7-8,10,12H,2-6,9H2,1H3,(H,18,19);1H |
| InChIKey | HDMULSOZGODSOC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride?
The IUPAC name of [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride (CID 141393691) is [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride.
What is the SMILES notation for [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride?
The canonical SMILES for [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride is CN1CCCCC1CCc1cc([N+](=O)[O-])ccc1OC(=O)O.Cl.
What is the InChIKey of [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride?
The InChIKey is HDMULSOZGODSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O5.ClH/c1-16-9-3-2-4-12(16)6-5-11-10-13(17(20)21)7-8-14(11)22-15(18)19;/h7-8,10,12H,2-6,9H2,1H3,(H,18,19);1H.
What are the key properties of [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride?
[2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride has a molecular weight of 344.80 g/mol, XLogP of 3.49, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(1-methylpiperidin-2-yl)ethyl]-4-nitrophenyl] hydrogen carbonate;hydrochloride is sourced from PubChem (CID 141393691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).