About (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate
(4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate (PubChem CID 129046819) has the molecular formula C13H15NO5S
and a molecular weight of 297.33 g/mol. Its IUPAC name is (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate.
Molecular Properties
| Compound Name | (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate |
| PubChem CID | 129046819 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate |
| SMILES | O=C(OCC1(S)CCCC1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15NO5S/c15-12(18-9-13(20)7-1-2-8-13)19-11-5-3-10(4-6-11)14(16)17/h3-6,20H,1-2,7-9H2 |
| InChIKey | GNIYDWRBMGZNGT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate?
The IUPAC name of (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate (CID 129046819) is (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate.
What is the SMILES notation for (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate?
The canonical SMILES for (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate is O=C(OCC1(S)CCCC1)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate?
The InChIKey is GNIYDWRBMGZNGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5S/c15-12(18-9-13(20)7-1-2-8-13)19-11-5-3-10(4-6-11)14(16)17/h3-6,20H,1-2,7-9H2.
What are the key properties of (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate?
(4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate has a molecular weight of 297.33 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) (1-sulfanylcyclopentyl)methyl carbonate is sourced from PubChem (CID 129046819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).