C22H22N4O5 — CID 166545198
(4-nitrophenyl) (2S)-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate (PubChem CID 166545198) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is (4-nitrophenyl) (2S)-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) (2S)-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166545198 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (4-nitrophenyl) (2S)-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)N1CCCC[C@H]1c1nc(CCc2ccccc2)no1 |
| InChI | InChI=1S/C22H22N4O5/c27-22(30-18-12-10-17(11-13-18)26(28)29)25-15-5-4-8-19(25)21-23-20(24-31-21)14-9-16-6-2-1-3-7-16/h1-3,6-7,10-13,19H,4-5,8-9,14-15H2/t19-/m0/s1 |
| InChIKey | FERAVUCISHWMGT-IBGZPJMESA-N |
| XLogP | 4.49 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|