C12H11ClN2O5 — CID 43387148
1-(2-chloro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 43387148) has the molecular formula C12H11ClN2O5 and a molecular weight of 298.68 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-chloro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43387148 |
| Molecular Formula | C12H11ClN2O5 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(2-chloro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C12H11ClN2O5/c13-9-4-3-7(15(19)20)6-8(9)11(16)14-5-1-2-10(14)12(17)18/h3-4,6,10H,1-2,5H2,(H,17,18) |
| InChIKey | BGNQNZWTPSZVBS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|