C12H10F2N2O5 — CID 61137837
(2S)-1-(2,4-difluoro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 61137837) has the molecular formula C12H10F2N2O5 and a molecular weight of 300.22 g/mol. Its IUPAC name is (2S)-1-(2,4-difluoro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2,4-difluoro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61137837 |
| Molecular Formula | C12H10F2N2O5 |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (2S)-1-(2,4-difluoro-5-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H10F2N2O5/c13-7-5-8(14)10(16(20)21)4-6(7)11(17)15-3-1-2-9(15)12(18)19/h4-5,9H,1-3H2,(H,18,19)/t9-/m0/s1 |
| InChIKey | SHTAYCUYHPYAIN-VIFPVBQESA-N |
| XLogP | 1.56 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|