C22H31N5O10 — CID 10075529
2-[4,10-bis(carboxymethyl)-7-[2-(3-nitrophenoxy)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 10075529) has the molecular formula C22H31N5O10 and a molecular weight of 525.52 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[2-(3-nitrophenoxy)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[2-(3-nitrophenoxy)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 10075529 |
| Molecular Formula | C22H31N5O10 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[2-(3-nitrophenoxy)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)Oc2cccc([N+](=O)[O-])c2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H31N5O10/c28-19(29)13-23-4-6-24(14-20(30)31)8-10-26(11-9-25(7-5-23)15-21(32)33)16-22(34)37-18-3-1-2-17(12-18)27(35)36/h1-3,12H,4-11,13-16H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | PWTPPVZYIHSHAY-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 194.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|