About (3-nitrophenyl) 2-benzhydryloxyacetate
(3-nitrophenyl) 2-benzhydryloxyacetate (PubChem CID 19020264) has the molecular formula C21H17NO5
and a molecular weight of 363.37 g/mol. Its IUPAC name is (3-nitrophenyl) 2-benzhydryloxyacetate.
Molecular Properties
| Compound Name | (3-nitrophenyl) 2-benzhydryloxyacetate |
| PubChem CID | 19020264 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3-nitrophenyl) 2-benzhydryloxyacetate |
| SMILES | O=C(COC(c1ccccc1)c1ccccc1)Oc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17NO5/c23-20(27-19-13-7-12-18(14-19)22(24)25)15-26-21(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-14,21H,15H2 |
| InChIKey | IMLOASVTJBLPEA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) 2-benzhydryloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) 2-benzhydryloxyacetate?
The IUPAC name of (3-nitrophenyl) 2-benzhydryloxyacetate (CID 19020264) is (3-nitrophenyl) 2-benzhydryloxyacetate.
What is the SMILES notation for (3-nitrophenyl) 2-benzhydryloxyacetate?
The canonical SMILES for (3-nitrophenyl) 2-benzhydryloxyacetate is O=C(COC(c1ccccc1)c1ccccc1)Oc1cccc([N+](=O)[O-])c1.
What is the InChIKey of (3-nitrophenyl) 2-benzhydryloxyacetate?
The InChIKey is IMLOASVTJBLPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO5/c23-20(27-19-13-7-12-18(14-19)22(24)25)15-26-21(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-14,21H,15H2.
What are the key properties of (3-nitrophenyl) 2-benzhydryloxyacetate?
(3-nitrophenyl) 2-benzhydryloxyacetate has a molecular weight of 363.37 g/mol, XLogP of 4.31, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) 2-benzhydryloxyacetate is sourced from PubChem (CID 19020264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).