About (3-nitrophenyl) N-ethylcarbamate
(3-nitrophenyl) N-ethylcarbamate (PubChem CID 57143264) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is (3-nitrophenyl) N-ethylcarbamate.
Molecular Properties
| Compound Name | (3-nitrophenyl) N-ethylcarbamate |
| PubChem CID | 57143264 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (3-nitrophenyl) N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N2O4/c1-2-10-9(12)15-8-5-3-4-7(6-8)11(13)14/h3-6H,2H2,1H3,(H,10,12) |
| InChIKey | QORDXYHNGOFYPB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) N-ethylcarbamate?
The IUPAC name of (3-nitrophenyl) N-ethylcarbamate (CID 57143264) is (3-nitrophenyl) N-ethylcarbamate.
What is the SMILES notation for (3-nitrophenyl) N-ethylcarbamate?
The canonical SMILES for (3-nitrophenyl) N-ethylcarbamate is CCNC(=O)Oc1cccc([N+](=O)[O-])c1.
What is the InChIKey of (3-nitrophenyl) N-ethylcarbamate?
The InChIKey is QORDXYHNGOFYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4/c1-2-10-9(12)15-8-5-3-4-7(6-8)11(13)14/h3-6H,2H2,1H3,(H,10,12).
What are the key properties of (3-nitrophenyl) N-ethylcarbamate?
(3-nitrophenyl) N-ethylcarbamate has a molecular weight of 210.19 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) N-ethylcarbamate is sourced from PubChem (CID 57143264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).