About O-(3-nitrophenyl) carbamothioate
O-(3-nitrophenyl) carbamothioate (PubChem CID 56992342) has the molecular formula C7H6N2O3S
and a molecular weight of 198.20 g/mol. Its IUPAC name is O-(3-nitrophenyl) carbamothioate.
Molecular Properties
| Compound Name | O-(3-nitrophenyl) carbamothioate |
| PubChem CID | 56992342 |
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | O-(3-nitrophenyl) carbamothioate |
| SMILES | NC(=S)Oc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N2O3S/c8-7(13)12-6-3-1-2-5(4-6)9(10)11/h1-4H,(H2,8,13) |
| InChIKey | QEWCKWNVQVZMME-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(3-nitrophenyl) carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(3-nitrophenyl) carbamothioate?
The IUPAC name of O-(3-nitrophenyl) carbamothioate (CID 56992342) is O-(3-nitrophenyl) carbamothioate.
What is the SMILES notation for O-(3-nitrophenyl) carbamothioate?
The canonical SMILES for O-(3-nitrophenyl) carbamothioate is NC(=S)Oc1cccc([N+](=O)[O-])c1.
What is the InChIKey of O-(3-nitrophenyl) carbamothioate?
The InChIKey is QEWCKWNVQVZMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3S/c8-7(13)12-6-3-1-2-5(4-6)9(10)11/h1-4H,(H2,8,13).
What are the key properties of O-(3-nitrophenyl) carbamothioate?
O-(3-nitrophenyl) carbamothioate has a molecular weight of 198.20 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(3-nitrophenyl) carbamothioate is sourced from PubChem (CID 56992342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).