About (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate
(3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate (PubChem CID 2827911) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate.
Molecular Properties
| Compound Name | (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate |
| PubChem CID | 2827911 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate |
| SMILES | O=C(Oc1cccc([N+](=O)[O-])c1)C1C2CCCCC21 |
| InChI | InChI=1S/C14H15NO4/c16-14(13-11-6-1-2-7-12(11)13)19-10-5-3-4-9(8-10)15(17)18/h3-5,8,11-13H,1-2,6-7H2 |
| InChIKey | DEVYNXLGCKFLFU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate?
The IUPAC name of (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate (CID 2827911) is (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate.
What is the SMILES notation for (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate?
The canonical SMILES for (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate is O=C(Oc1cccc([N+](=O)[O-])c1)C1C2CCCCC21.
What is the InChIKey of (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate?
The InChIKey is DEVYNXLGCKFLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c16-14(13-11-6-1-2-7-12(11)13)19-10-5-3-4-9(8-10)15(17)18/h3-5,8,11-13H,1-2,6-7H2.
What are the key properties of (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate?
(3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate has a molecular weight of 261.28 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) bicyclo[4.1.0]heptane-7-carboxylate is sourced from PubChem (CID 2827911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).