C34H46N6O11 — CID 134551991
methyl 2-[4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 134551991) has the molecular formula C34H46N6O11 and a molecular weight of 714.77 g/mol. Its IUPAC name is methyl 2-[4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | methyl 2-[4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 134551991 |
| Molecular Formula | C34H46N6O11 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | methyl 2-[4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(CC(=O)OC)CCN(CC(=O)N(CC(=O)Oc2ccc([N+](=O)[O-])cc2)Cc2ccccc2)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C34H46N6O11/c1-48-31(42)23-36-15-13-35(14-16-37(24-32(43)49-2)18-20-38(19-17-36)25-33(44)50-3)22-30(41)39(21-27-7-5-4-6-8-27)26-34(45)51-29-11-9-28(10-12-29)40(46)47/h4-12H,13-26H2,1-3H3 |
| InChIKey | QMLRNKTXWMIYLO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 181.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|