C27H37GdN6O12 — CID 134540778
2-[4,7-bis(carboxylatomethyl)-10-[2-[2-methoxyethyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (PubChem CID 134540778) has the molecular formula C27H37GdN6O12 and a molecular weight of 794.87 g/mol. Its IUPAC name is 2-[4,7-bis(carboxylatomethyl)-10-[2-[2-methoxyethyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+).
| Compound Name | 2-[4,7-bis(carboxylatomethyl)-10-[2-[2-methoxyethyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 134540778 |
| Molecular Formula | C27H37GdN6O12 |
| Molecular Weight | 794.87 g/mol |
| Exact Mass | 795.17 |
| IUPAC Name | 2-[4,7-bis(carboxylatomethyl)-10-[2-[2-methoxyethyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| SMILES | COCCN(CC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)CN1CCN(CC(=O)[O-])CCN(CC(=O)[O-])CCN(CC(=O)[O-])CC1.[Gd+3] |
| InChI | InChI=1S/C27H40N6O12.Gd/c1-44-15-14-32(20-27(41)45-22-4-2-21(3-5-22)33(42)43)23(34)16-28-6-8-29(17-24(35)36)10-12-31(19-26(39)40)13-11-30(9-7-28)18-25(37)38;/h2-5H,6-20H2,1H3,(H,35,36)(H,37,38)(H,39,40);/q;+3/p-3 |
| InChIKey | CXWAKJCGYSBVQS-UHFFFAOYSA-K |
| XLogP | -5.55 |
| TPSA | 232.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.87 |
| LogP ≤ 5 | -5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|