C22H29NO6 — CID 167318522
2-[[4-[1-(2-methoxyethyl)-2H-pyridin-3-yl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid (PubChem CID 167318522) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[[4-[1-(2-methoxyethyl)-2H-pyridin-3-yl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid.
| Compound Name | 2-[[4-[1-(2-methoxyethyl)-2H-pyridin-3-yl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid |
|---|---|
| PubChem CID | 167318522 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[[4-[1-(2-methoxyethyl)-2H-pyridin-3-yl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid |
| SMILES | COCCN1C=CC=C(c2ccc(CC(OC(C)(C)C)(C(=O)O)C(=O)O)cc2)C1 |
| InChI | InChI=1S/C22H29NO6/c1-21(2,3)29-22(19(24)25,20(26)27)14-16-7-9-17(10-8-16)18-6-5-11-23(15-18)12-13-28-4/h5-11H,12-15H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | RCVPWICCEAAJAP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|