C19H27NO8 — CID 68792350
2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioic acid (PubChem CID 68792350) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is 2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioic acid.
| Compound Name | 2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 68792350 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioic acid |
| SMILES | COC(Cc1ccc(OCCNCC(=O)OC(C)(C)C)cc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H27NO8/c1-18(2,3)28-15(21)12-20-9-10-27-14-7-5-13(6-8-14)11-19(26-4,16(22)23)17(24)25/h5-8,20H,9-12H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | SSYDCHFHGZMXBA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|