C21H31NO8 — CID 68792352
dimethyl 2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioate (PubChem CID 68792352) has the molecular formula C21H31NO8 and a molecular weight of 425.48 g/mol. Its IUPAC name is dimethyl 2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 68792352 |
| Molecular Formula | C21H31NO8 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | dimethyl 2-methoxy-2-[[4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc(OCCNCC(=O)OC(C)(C)C)cc1)(OC)C(=O)OC |
| InChI | InChI=1S/C21H31NO8/c1-20(2,3)30-17(23)14-22-11-12-29-16-9-7-15(8-10-16)13-21(28-6,18(24)26-4)19(25)27-5/h7-10,22H,11-14H2,1-6H3 |
| InChIKey | UXIKVPROLFLCKY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|