C16H15NO5 — CID 135182415
2-methoxy-2-[(4-pyridin-2-ylphenyl)methyl]propanedioic acid (PubChem CID 135182415) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-methoxy-2-[(4-pyridin-2-ylphenyl)methyl]propanedioic acid.
| Compound Name | 2-methoxy-2-[(4-pyridin-2-ylphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 135182415 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-methoxy-2-[(4-pyridin-2-ylphenyl)methyl]propanedioic acid |
| SMILES | COC(Cc1ccc(-c2ccccn2)cc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H15NO5/c1-22-16(14(18)19,15(20)21)10-11-5-7-12(8-6-11)13-4-2-3-9-17-13/h2-9H,10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | QNQLYGGOMWMTPE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|