C14H13F3N2O2 — CID 68670040
(4-pyridin-2-ylphenyl)methanamine;2,2,2-trifluoroacetic acid (PubChem CID 68670040) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is (4-pyridin-2-ylphenyl)methanamine;2,2,2-trifluoroacetic acid.
| Compound Name | (4-pyridin-2-ylphenyl)methanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68670040 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (4-pyridin-2-ylphenyl)methanamine;2,2,2-trifluoroacetic acid |
| SMILES | NCc1ccc(-c2ccccn2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H12N2.C2HF3O2/c13-9-10-4-6-11(7-5-10)12-3-1-2-8-14-12;3-2(4,5)1(6)7/h1-8H,9,13H2;(H,6,7) |
| InChIKey | CUMNWSKCPRLURB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |