C26H27F6N3O5 — CID 175969875
N-[(5S,7R)-3-amino-1-adamantyl]-4-pyridin-2-ylbenzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175969875) has the molecular formula C26H27F6N3O5 and a molecular weight of 575.51 g/mol. Its IUPAC name is N-[(5S,7R)-3-amino-1-adamantyl]-4-pyridin-2-ylbenzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[(5S,7R)-3-amino-1-adamantyl]-4-pyridin-2-ylbenzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175969875 |
| Molecular Formula | C26H27F6N3O5 |
| Molecular Weight | 575.51 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | N-[(5S,7R)-3-amino-1-adamantyl]-4-pyridin-2-ylbenzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC12C[C@H]3C[C@@H](C1)CC(NC(=O)c1ccc(-c4ccccn4)cc1)(C3)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H25N3O.2C2HF3O2/c23-21-10-15-9-16(11-21)13-22(12-15,14-21)25-20(26)18-6-4-17(5-7-18)19-3-1-2-8-24-19;2*3-2(4,5)1(6)7/h1-8,15-16H,9-14,23H2,(H,25,26);2*(H,6,7)/t15-,16+,21?,22?;; |
| InChIKey | FUPBSDAJSNAFEE-NEXVJNRBSA-N |
| XLogP | 4.80 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |