About N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide
N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide (PubChem CID 175969711) has the molecular formula C22H25N3O
and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide |
| PubChem CID | 175969711 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide |
| SMILES | NC12C[C@H]3C[C@@H](C1)CC(NC(=O)c1ccc(-c4ccccc4)nc1)(C3)C2 |
| InChI | InChI=1S/C22H25N3O/c23-21-9-15-8-16(10-21)12-22(11-15,14-21)25-20(26)18-6-7-19(24-13-18)17-4-2-1-3-5-17/h1-7,13,15-16H,8-12,14,23H2,(H,25,26)/t15-,16+,21?,22? |
| InChIKey | BMILEBUAPVPALU-MBWAJUJLSA-N |
| XLogP | 3.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide?
The IUPAC name of N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide (CID 175969711) is N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide.
What is the SMILES notation for N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide?
The canonical SMILES for N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide is NC12C[C@H]3C[C@@H](C1)CC(NC(=O)c1ccc(-c4ccccc4)nc1)(C3)C2.
What is the InChIKey of N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide?
The InChIKey is BMILEBUAPVPALU-MBWAJUJLSA-N. The full InChI is InChI=1S/C22H25N3O/c23-21-9-15-8-16(10-21)12-22(11-15,14-21)25-20(26)18-6-7-19(24-13-18)17-4-2-1-3-5-17/h1-7,13,15-16H,8-12,14,23H2,(H,25,26)/t15-,16+,21?,22?.
What are the key properties of N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide?
N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide has a molecular weight of 347.46 g/mol, XLogP of 3.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5S,7R)-3-amino-1-adamantyl]-6-phenylpyridine-3-carboxamide is sourced from PubChem (CID 175969711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).