C15H21N3OS — CID 67480762
N-(3-amino-1-adamantyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 67480762) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is N-(3-amino-1-adamantyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-amino-1-adamantyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 67480762 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-(3-amino-1-adamantyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC23CC4CC(CC(N)(C4)C2)C3)cs1 |
| InChI | InChI=1S/C15H21N3OS/c1-9-17-12(7-20-9)13(19)18-15-5-10-2-11(6-15)4-14(16,3-10)8-15/h7,10-11H,2-6,8,16H2,1H3,(H,18,19) |
| InChIKey | DCJQCGCLDKQQNG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |