C19H29N3OS — CID 5177534
N-(1-adamantyl)-2-(1-aminopentyl)-1,3-thiazole-4-carboxamide (PubChem CID 5177534) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(1-aminopentyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1-adamantyl)-2-(1-aminopentyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 5177534 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-(1-adamantyl)-2-(1-aminopentyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCC(N)c1nc(C(=O)NC23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C19H29N3OS/c1-2-3-4-15(20)18-21-16(11-24-18)17(23)22-19-8-12-5-13(9-19)7-14(6-12)10-19/h11-15H,2-10,20H2,1H3,(H,22,23) |
| InChIKey | KCAWGDYKGFGDHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |