C26H34N2OS — CID 11560872
N-(1-adamantyl)-5-hexan-2-yl-4-phenyl-1,3-thiazole-2-carboxamide (PubChem CID 11560872) has the molecular formula C26H34N2OS and a molecular weight of 422.64 g/mol. Its IUPAC name is N-(1-adamantyl)-5-hexan-2-yl-4-phenyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-(1-adamantyl)-5-hexan-2-yl-4-phenyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 11560872 |
| Molecular Formula | C26H34N2OS |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-(1-adamantyl)-5-hexan-2-yl-4-phenyl-1,3-thiazole-2-carboxamide |
| SMILES | CCCCC(C)c1sc(C(=O)NC23CC4CC(CC(C4)C2)C3)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H34N2OS/c1-3-4-8-17(2)23-22(21-9-6-5-7-10-21)27-25(30-23)24(29)28-26-14-18-11-19(15-26)13-20(12-18)16-26/h5-7,9-10,17-20H,3-4,8,11-16H2,1-2H3,(H,28,29) |
| InChIKey | AZMBHZYAEBZXPH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |