C28H40N4O2 — CID 5006831
3-(1-adamantyl)-1-butyl-1-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]urea (PubChem CID 5006831) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is 3-(1-adamantyl)-1-butyl-1-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]urea.
| Compound Name | 3-(1-adamantyl)-1-butyl-1-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 5006831 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | 3-(1-adamantyl)-1-butyl-1-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]urea |
| SMILES | CCCCN(C(=O)NC12CC3CC(CC(C3)C1)C2)C(C)c1nc2ccccc2c(=O)n1CCC |
| InChI | InChI=1S/C28H40N4O2/c1-4-6-12-31(27(34)30-28-16-20-13-21(17-28)15-22(14-20)18-28)19(3)25-29-24-10-8-7-9-23(24)26(33)32(25)11-5-2/h7-10,19-22H,4-6,11-18H2,1-3H3,(H,30,34) |
| InChIKey | QCNPZPGHIHQCLA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |