C17H22N6OS — CID 131932570
2-(2-methyl-1,3-thiazol-4-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide (PubChem CID 131932570) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 131932570 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide |
| SMILES | Cc1nc(CC(=O)NC23CC4CC(C2)CC(n2ncnn2)(C4)C3)cs1 |
| InChI | InChI=1S/C17H22N6OS/c1-11-20-14(8-25-11)3-15(24)21-16-4-12-2-13(5-16)7-17(6-12,9-16)23-19-10-18-22-23/h8,10,12-13H,2-7,9H2,1H3,(H,21,24) |
| InChIKey | BOKIRBKTPWGQLV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |