C13H20N6O — CID 98138161
2-[(5S,7S)-3-(tetrazol-2-yl)-1-adamantyl]acetohydrazide (PubChem CID 98138161) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[(5S,7S)-3-(tetrazol-2-yl)-1-adamantyl]acetohydrazide.
| Compound Name | 2-[(5S,7S)-3-(tetrazol-2-yl)-1-adamantyl]acetohydrazide |
|---|---|
| PubChem CID | 98138161 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[(5S,7S)-3-(tetrazol-2-yl)-1-adamantyl]acetohydrazide |
| SMILES | NNC(=O)CC12C[C@@H]3C[C@@H](C1)CC(n1ncnn1)(C3)C2 |
| InChI | InChI=1S/C13H20N6O/c14-17-11(20)6-12-2-9-1-10(3-12)5-13(4-9,7-12)19-16-8-15-18-19/h8-10H,1-7,14H2,(H,17,20)/t9-,10-,12?,13?/m0/s1 |
| InChIKey | BODJGEZOICZQSL-WPMGSTCASA-N |
| XLogP | 0.35 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|