About 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide
2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide (PubChem CID 131902137) has the molecular formula C21H25N7O
and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide.
Molecular Properties
| Compound Name | 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide |
| PubChem CID | 131902137 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide |
| SMILES | Cc1cccn2c(CC(=O)NC34CC5CC(C3)CC(n3ncnn3)(C5)C4)cnc12 |
| InChI | InChI=1S/C21H25N7O/c1-14-3-2-4-27-17(11-22-19(14)27)6-18(29)25-20-7-15-5-16(8-20)10-21(9-15,12-20)28-24-13-23-26-28/h2-4,11,13,15-16H,5-10,12H2,1H3,(H,25,29) |
| InChIKey | RMTVDASWOXBIKY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide?
The IUPAC name of 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide (CID 131902137) is 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide.
What is the SMILES notation for 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide?
The canonical SMILES for 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide is Cc1cccn2c(CC(=O)NC34CC5CC(C3)CC(n3ncnn3)(C5)C4)cnc12.
What is the InChIKey of 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide?
The InChIKey is RMTVDASWOXBIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N7O/c1-14-3-2-4-27-17(11-22-19(14)27)6-18(29)25-20-7-15-5-16(8-20)10-21(9-15,12-20)28-24-13-23-26-28/h2-4,11,13,15-16H,5-10,12H2,1H3,(H,25,29).
What are the key properties of 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide?
2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide has a molecular weight of 391.48 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]acetamide is sourced from PubChem (CID 131902137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).