C16H21N7 — CID 131939533
N-(pyrimidin-5-ylmethyl)-3-(tetrazol-2-yl)adamantan-1-amine (PubChem CID 131939533) has the molecular formula C16H21N7 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-(pyrimidin-5-ylmethyl)-3-(tetrazol-2-yl)adamantan-1-amine.
| Compound Name | N-(pyrimidin-5-ylmethyl)-3-(tetrazol-2-yl)adamantan-1-amine |
|---|---|
| PubChem CID | 131939533 |
| Molecular Formula | C16H21N7 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-(pyrimidin-5-ylmethyl)-3-(tetrazol-2-yl)adamantan-1-amine |
| SMILES | c1ncc(CNC23CC4CC(C2)CC(n2ncnn2)(C4)C3)cn1 |
| InChI | InChI=1S/C16H21N7/c1-12-2-15(19-8-14-6-17-10-18-7-14)3-13(1)5-16(4-12,9-15)23-21-11-20-22-23/h6-7,10-13,19H,1-5,8-9H2 |
| InChIKey | IQJXLSOUXRTPER-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |