C20H28N8O — CID 134707002
1-[2-[[3-(tetrazol-2-yl)-1-adamantyl]amino]pyrimidin-4-yl]piperidin-4-ol (PubChem CID 134707002) has the molecular formula C20H28N8O and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-[2-[[3-(tetrazol-2-yl)-1-adamantyl]amino]pyrimidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[2-[[3-(tetrazol-2-yl)-1-adamantyl]amino]pyrimidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 134707002 |
| Molecular Formula | C20H28N8O |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-[2-[[3-(tetrazol-2-yl)-1-adamantyl]amino]pyrimidin-4-yl]piperidin-4-ol |
| SMILES | OC1CCN(c2ccnc(NC34CC5CC(C3)CC(n3ncnn3)(C5)C4)n2)CC1 |
| InChI | InChI=1S/C20H28N8O/c29-16-2-5-27(6-3-16)17-1-4-21-18(24-17)25-19-8-14-7-15(9-19)11-20(10-14,12-19)28-23-13-22-26-28/h1,4,13-16,29H,2-3,5-12H2,(H,21,24,25) |
| InChIKey | FXGUZYAEZCRKTR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |