C18H22N8O — CID 171139595
3-(2-aminopyrimidin-5-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]prop-2-enamide (PubChem CID 171139595) has the molecular formula C18H22N8O and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-(2-aminopyrimidin-5-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]prop-2-enamide.
| Compound Name | 3-(2-aminopyrimidin-5-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]prop-2-enamide |
|---|---|
| PubChem CID | 171139595 |
| Molecular Formula | C18H22N8O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-(2-aminopyrimidin-5-yl)-N-[3-(tetrazol-2-yl)-1-adamantyl]prop-2-enamide |
| SMILES | Nc1ncc(C=CC(=O)NC23CC4CC(C2)CC(n2ncnn2)(C4)C3)cn1 |
| InChI | InChI=1S/C18H22N8O/c19-16-20-8-12(9-21-16)1-2-15(27)24-17-4-13-3-14(5-17)7-18(6-13,10-17)26-23-11-22-25-26/h1-2,8-9,11,13-14H,3-7,10H2,(H,24,27)(H2,19,20,21) |
| InChIKey | SJUHTRSGJGFIIZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|