C17H25N5O — CID 843354
(5S,7R)-N-cyclopentyl-3-(tetrazol-2-yl)adamantane-1-carboxamide (PubChem CID 843354) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is (5S,7R)-N-cyclopentyl-3-(tetrazol-2-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-cyclopentyl-3-(tetrazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 843354 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (5S,7R)-N-cyclopentyl-3-(tetrazol-2-yl)adamantane-1-carboxamide |
| SMILES | O=C(NC1CCCC1)C12C[C@H]3C[C@@H](C1)CC(n1ncnn1)(C3)C2 |
| InChI | InChI=1S/C17H25N5O/c23-15(20-14-3-1-2-4-14)16-6-12-5-13(7-16)9-17(8-12,10-16)22-19-11-18-21-22/h11-14H,1-10H2,(H,20,23)/t12-,13+,16?,17? |
| InChIKey | DUCBMBFDCPZSMX-ZPVISIIKSA-N |
| XLogP | 2.03 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |